C26H42O4 — CID 156768302
methyl (13R,14S)-13-[(4-methoxyphenyl)methoxy]-14-methylhexadec-9-enoate (PubChem CID 156768302) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is methyl (13R,14S)-13-[(4-methoxyphenyl)methoxy]-14-methylhexadec-9-enoate.
| Compound Name | methyl (13R,14S)-13-[(4-methoxyphenyl)methoxy]-14-methylhexadec-9-enoate |
|---|---|
| PubChem CID | 156768302 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | methyl (13R,14S)-13-[(4-methoxyphenyl)methoxy]-14-methylhexadec-9-enoate |
| SMILES | CC[C@H](C)[C@@H](CCC=CCCCCCCCC(=O)OC)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H42O4/c1-5-22(2)25(30-21-23-17-19-24(28-3)20-18-23)15-13-11-9-7-6-8-10-12-14-16-26(27)29-4/h9,11,17-20,22,25H,5-8,10,12-16,21H2,1-4H3/t22-,25+/m0/s1 |
| InChIKey | HSWMYPSSJDJJMQ-WIOPSUGQSA-N |
| XLogP | 6.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|