C16H23NO5 — CID 145473731
N-hydroxy-7-[(4-methoxyphenyl)methoxy]-8-oxooctanamide (PubChem CID 145473731) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is N-hydroxy-7-[(4-methoxyphenyl)methoxy]-8-oxooctanamide.
| Compound Name | N-hydroxy-7-[(4-methoxyphenyl)methoxy]-8-oxooctanamide |
|---|---|
| PubChem CID | 145473731 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N-hydroxy-7-[(4-methoxyphenyl)methoxy]-8-oxooctanamide |
| SMILES | COc1ccc(COC(C=O)CCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C16H23NO5/c1-21-14-9-7-13(8-10-14)12-22-15(11-18)5-3-2-4-6-16(19)17-20/h7-11,15,20H,2-6,12H2,1H3,(H,17,19) |
| InChIKey | GZFDKUMKYDLWHM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|