C21H26N2O5 — CID 25065926
N'-hydroxy-2-[(4-methoxyphenyl)methoxy]-N-phenylheptanediamide (PubChem CID 25065926) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is N'-hydroxy-2-[(4-methoxyphenyl)methoxy]-N-phenylheptanediamide.
| Compound Name | N'-hydroxy-2-[(4-methoxyphenyl)methoxy]-N-phenylheptanediamide |
|---|---|
| PubChem CID | 25065926 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N'-hydroxy-2-[(4-methoxyphenyl)methoxy]-N-phenylheptanediamide |
| SMILES | COc1ccc(COC(CCCCC(=O)NO)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-27-18-13-11-16(12-14-18)15-28-19(9-5-6-10-20(24)23-26)21(25)22-17-7-3-2-4-8-17/h2-4,7-8,11-14,19,26H,5-6,9-10,15H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | OZJXHJVEBWDACK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|