C15H22N2O4 — CID 25065930
N'-hydroxy-2-methoxy-N-phenyloctanediamide (PubChem CID 25065930) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is N'-hydroxy-2-methoxy-N-phenyloctanediamide.
| Compound Name | N'-hydroxy-2-methoxy-N-phenyloctanediamide |
|---|---|
| PubChem CID | 25065930 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N'-hydroxy-2-methoxy-N-phenyloctanediamide |
| SMILES | COC(CCCCCC(=O)NO)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H22N2O4/c1-21-13(10-6-3-7-11-14(18)17-20)15(19)16-12-8-4-2-5-9-12/h2,4-5,8-9,13,20H,3,6-7,10-11H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | JHNWNLJPMOWGAH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|