C35H49N3O8 — CID 159093312
N'-hydroxy-N-phenyl-2-prop-2-enoxyoctanediamide;methyl 8-anilino-8-oxo-7-prop-2-enoxyoctanoate (PubChem CID 159093312) has the molecular formula C35H49N3O8 and a molecular weight of 639.79 g/mol. Its IUPAC name is N'-hydroxy-N-phenyl-2-prop-2-enoxyoctanediamide;methyl 8-anilino-8-oxo-7-prop-2-enoxyoctanoate.
| Compound Name | N'-hydroxy-N-phenyl-2-prop-2-enoxyoctanediamide;methyl 8-anilino-8-oxo-7-prop-2-enoxyoctanoate |
|---|---|
| PubChem CID | 159093312 |
| Molecular Formula | C35H49N3O8 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.35 |
| IUPAC Name | N'-hydroxy-N-phenyl-2-prop-2-enoxyoctanediamide;methyl 8-anilino-8-oxo-7-prop-2-enoxyoctanoate |
| SMILES | C=CCOC(CCCCCC(=O)NO)C(=O)Nc1ccccc1.C=CCOC(CCCCCC(=O)OC)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H25NO4.C17H24N2O4/c1-3-14-23-16(12-8-5-9-13-17(20)22-2)18(21)19-15-10-6-4-7-11-15;1-2-13-23-15(11-7-4-8-12-16(20)19-22)17(21)18-14-9-5-3-6-10-14/h3-4,6-7,10-11,16H,1,5,8-9,12-14H2,2H3,(H,19,21);2-3,5-6,9-10,15,22H,1,4,7-8,11-13H2,(H,18,21)(H,19,20) |
| InChIKey | KCIPPBBFYISHHM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|