C23H33NO5 — CID 141215245
8-(2-hex-5-enoxyanilino)-8-oxo-7-prop-2-enoxyoctanoic acid (PubChem CID 141215245) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is 8-(2-hex-5-enoxyanilino)-8-oxo-7-prop-2-enoxyoctanoic acid.
| Compound Name | 8-(2-hex-5-enoxyanilino)-8-oxo-7-prop-2-enoxyoctanoic acid |
|---|---|
| PubChem CID | 141215245 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 8-(2-hex-5-enoxyanilino)-8-oxo-7-prop-2-enoxyoctanoic acid |
| SMILES | C=CCCCCOc1ccccc1NC(=O)C(CCCCCC(=O)O)OCC=C |
| InChI | InChI=1S/C23H33NO5/c1-3-5-6-12-18-29-20-14-11-10-13-19(20)24-23(27)21(28-17-4-2)15-8-7-9-16-22(25)26/h3-4,10-11,13-14,21H,1-2,5-9,12,15-18H2,(H,24,27)(H,25,26) |
| InChIKey | NSKXLAYXXJHOAJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|