2-[2-(pent-4-enoylamino)phenoxy]acetic acid

C13H15NO4 — CID 55242650

IUPAC2-[2-(pent-4-enoylamino)phenoxy]acetic acid
SMILESC=CCCC(=O)Nc1ccccc1OCC(=O)O
InChIInChI=1S/C13H15NO4/c1-2-3-8-12(15)14-10-6-4-5-7-11(10)18-9-13(16)17/h2,4-7H,1,3,8-9H2,(H,14,15)(H,16,17)
InChIKeyNQSGISKLUYTVHY-UHFFFAOYSA-N
MW249.27 g/mol
LogP2.05
Rot. Bonds7

About 2-[2-(pent-4-enoylamino)phenoxy]acetic acid

2-[2-(pent-4-enoylamino)phenoxy]acetic acid (PubChem CID 55242650) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-[2-(pent-4-enoylamino)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[2-(pent-4-enoylamino)phenoxy]acetic acid
PubChem CID55242650
Molecular FormulaC13H15NO4
Molecular Weight249.27 g/mol
Exact Mass249.10
IUPAC Name2-[2-(pent-4-enoylamino)phenoxy]acetic acid
SMILESC=CCCC(=O)Nc1ccccc1OCC(=O)O
InChIInChI=1S/C13H15NO4/c1-2-3-8-12(15)14-10-6-4-5-7-11(10)18-9-13(16)17/h2,4-7H,1,3,8-9H2,(H,14,15)(H,16,17)
InChIKeyNQSGISKLUYTVHY-UHFFFAOYSA-N
XLogP2.05
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.27
LogP ≤ 52.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-[2-(pent-4-enoylamino)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

11-[2-(carboxymethoxy)anilino]-11-oxoundecanoic acid
CID 18795886
2-[2-[(3-oxo-3-phenylpropanoyl)amino]phenoxy]acetic acid
CID 35261813
N-(2-ethenylphenyl)pent-4-enamide
CID 71373130
12-[2-(4-carboxybutoxy)anilino]-12-oxododecanoic acid
CID 18796099
10-[2-(3-carboxypropoxy)anilino]-10-oxodecanoic acid
CID 18796122
2-[2-(2-methylprop-2-enoylamino)phenoxy]acetic acid
CID 13070434
2-[2-(3-methylbut-2-enoylamino)phenoxy]acetic acid
CID 55241875
2-[2-[(3-methoxy-3-methylbutanoyl)amino]phenoxy]acetic acid
CID 103018697
2-[2-[[3-(methylamino)-3-oxopropyl]carbamoylamino]phenoxy]acetic acid
CID 63747077
N,N'-bis[2-(2-phenoxyethoxy)phenyl]pentanediamide
CID 17131186
5-oxo-5-[2-(2-phenoxyethoxy)anilino]pentanoic acid
CID 17130914
2-[2-(but-2-ynoylamino)phenoxy]acetic acid
CID 107986692

Frequently Asked Questions

What is the IUPAC name of 2-[2-(pent-4-enoylamino)phenoxy]acetic acid?
The IUPAC name of 2-[2-(pent-4-enoylamino)phenoxy]acetic acid (CID 55242650) is 2-[2-(pent-4-enoylamino)phenoxy]acetic acid.
What is the SMILES notation for 2-[2-(pent-4-enoylamino)phenoxy]acetic acid?
The canonical SMILES for 2-[2-(pent-4-enoylamino)phenoxy]acetic acid is C=CCCC(=O)Nc1ccccc1OCC(=O)O.
What is the InChIKey of 2-[2-(pent-4-enoylamino)phenoxy]acetic acid?
The InChIKey is NQSGISKLUYTVHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c1-2-3-8-12(15)14-10-6-4-5-7-11(10)18-9-13(16)17/h2,4-7H,1,3,8-9H2,(H,14,15)(H,16,17).
What are the key properties of 2-[2-(pent-4-enoylamino)phenoxy]acetic acid?
2-[2-(pent-4-enoylamino)phenoxy]acetic acid has a molecular weight of 249.27 g/mol, XLogP of 2.05, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(pent-4-enoylamino)phenoxy]acetic acid is sourced from PubChem (CID 55242650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).