C19H23N3O4S — CID 23557354
N'-hydroxy-N-phenyl-2-(thiophene-2-carbonylamino)octanediamide (PubChem CID 23557354) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N'-hydroxy-N-phenyl-2-(thiophene-2-carbonylamino)octanediamide.
| Compound Name | N'-hydroxy-N-phenyl-2-(thiophene-2-carbonylamino)octanediamide |
|---|---|
| PubChem CID | 23557354 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N'-hydroxy-N-phenyl-2-(thiophene-2-carbonylamino)octanediamide |
| SMILES | O=C(CCCCCC(NC(=O)c1cccs1)C(=O)Nc1ccccc1)NO |
| InChI | InChI=1S/C19H23N3O4S/c23-17(22-26)12-6-2-5-10-15(21-19(25)16-11-7-13-27-16)18(24)20-14-8-3-1-4-9-14/h1,3-4,7-9,11,13,15,26H,2,5-6,10,12H2,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | LMVPKTRCGGXYDS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|