C18H25N3O5S2 — CID 89190410
(2S)-2-(2,3-dihydrothiophen-2-ylsulfonylamino)-N'-hydroxy-N-phenyloctanediamide (PubChem CID 89190410) has the molecular formula C18H25N3O5S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydrothiophen-2-ylsulfonylamino)-N'-hydroxy-N-phenyloctanediamide.
| Compound Name | (2S)-2-(2,3-dihydrothiophen-2-ylsulfonylamino)-N'-hydroxy-N-phenyloctanediamide |
|---|---|
| PubChem CID | 89190410 |
| Molecular Formula | C18H25N3O5S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (2S)-2-(2,3-dihydrothiophen-2-ylsulfonylamino)-N'-hydroxy-N-phenyloctanediamide |
| SMILES | O=C(CCCCC[C@H](NS(=O)(=O)C1CC=CS1)C(=O)Nc1ccccc1)NO |
| InChI | InChI=1S/C18H25N3O5S2/c22-16(20-24)11-6-2-5-10-15(18(23)19-14-8-3-1-4-9-14)21-28(25,26)17-12-7-13-27-17/h1,3-4,7-9,13,15,17,21,24H,2,5-6,10-12H2,(H,19,23)(H,20,22)/t15-,17?/m0/s1 |
| InChIKey | KJRFIZFRHQYNEZ-MYJWUSKBSA-N |
| XLogP | 2.35 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|