C21H31N3O4 — CID 23557292
2-(cyclohexanecarbonylamino)-N'-hydroxy-N-phenyloctanediamide (PubChem CID 23557292) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-(cyclohexanecarbonylamino)-N'-hydroxy-N-phenyloctanediamide.
| Compound Name | 2-(cyclohexanecarbonylamino)-N'-hydroxy-N-phenyloctanediamide |
|---|---|
| PubChem CID | 23557292 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 2-(cyclohexanecarbonylamino)-N'-hydroxy-N-phenyloctanediamide |
| SMILES | O=C(CCCCCC(NC(=O)C1CCCCC1)C(=O)Nc1ccccc1)NO |
| InChI | InChI=1S/C21H31N3O4/c25-19(24-28)15-9-3-8-14-18(21(27)22-17-12-6-2-7-13-17)23-20(26)16-10-4-1-5-11-16/h2,6-7,12-13,16,18,28H,1,3-5,8-11,14-15H2,(H,22,27)(H,23,26)(H,24,25) |
| InChIKey | SOHCAGOJUINGTO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|