C31H37N3O3 — CID 69319082
1-methyl-N-[(2S)-1-(naphthalen-2-ylamino)-1,8-dioxo-8-phenyloctan-2-yl]piperidine-3-carboxamide (PubChem CID 69319082) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is 1-methyl-N-[(2S)-1-(naphthalen-2-ylamino)-1,8-dioxo-8-phenyloctan-2-yl]piperidine-3-carboxamide.
| Compound Name | 1-methyl-N-[(2S)-1-(naphthalen-2-ylamino)-1,8-dioxo-8-phenyloctan-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 69319082 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 1-methyl-N-[(2S)-1-(naphthalen-2-ylamino)-1,8-dioxo-8-phenyloctan-2-yl]piperidine-3-carboxamide |
| SMILES | CN1CCCC(C(=O)N[C@@H](CCCCCC(=O)c2ccccc2)C(=O)Nc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C31H37N3O3/c1-34-20-10-15-26(22-34)30(36)33-28(16-6-3-7-17-29(35)24-12-4-2-5-13-24)31(37)32-27-19-18-23-11-8-9-14-25(23)21-27/h2,4-5,8-9,11-14,18-19,21,26,28H,3,6-7,10,15-17,20,22H2,1H3,(H,32,37)(H,33,36)/t26?,28-/m0/s1 |
| InChIKey | CQIPSNMWUDVCCF-RXBHZZDJSA-N |
| XLogP | 5.44 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|