C26H36N2O3 — CID 69322278
(2S)-2-(4-methylpentanoylamino)-N-naphthalen-2-yl-8-oxodecanamide (PubChem CID 69322278) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is (2S)-2-(4-methylpentanoylamino)-N-naphthalen-2-yl-8-oxodecanamide.
| Compound Name | (2S)-2-(4-methylpentanoylamino)-N-naphthalen-2-yl-8-oxodecanamide |
|---|---|
| PubChem CID | 69322278 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | (2S)-2-(4-methylpentanoylamino)-N-naphthalen-2-yl-8-oxodecanamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)CCC(C)C)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H36N2O3/c1-4-23(29)12-6-5-7-13-24(28-25(30)17-14-19(2)3)26(31)27-22-16-15-20-10-8-9-11-21(20)18-22/h8-11,15-16,18-19,24H,4-7,12-14,17H2,1-3H3,(H,27,31)(H,28,30)/t24-/m0/s1 |
| InChIKey | IIJPTSDTGYNEJB-DEOSSOPVSA-N |
| XLogP | 5.63 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|