C24H36N2O4 — CID 69320613
(2S)-N-(3-acetylphenyl)-2-(4-methylpentanoylamino)-8-oxodecanamide (PubChem CID 69320613) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is (2S)-N-(3-acetylphenyl)-2-(4-methylpentanoylamino)-8-oxodecanamide.
| Compound Name | (2S)-N-(3-acetylphenyl)-2-(4-methylpentanoylamino)-8-oxodecanamide |
|---|---|
| PubChem CID | 69320613 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (2S)-N-(3-acetylphenyl)-2-(4-methylpentanoylamino)-8-oxodecanamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)CCC(C)C)C(=O)Nc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C24H36N2O4/c1-5-21(28)12-7-6-8-13-22(26-23(29)15-14-17(2)3)24(30)25-20-11-9-10-19(16-20)18(4)27/h9-11,16-17,22H,5-8,12-15H2,1-4H3,(H,25,30)(H,26,29)/t22-/m0/s1 |
| InChIKey | UNKFDUWQMOXFGS-QFIPXVFZSA-N |
| XLogP | 4.68 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|