C26H28N2O3S — CID 69318429
N-[(2S)-1,8-dioxo-1-(3-phenylanilino)nonan-2-yl]thiophene-3-carboxamide (PubChem CID 69318429) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[(2S)-1,8-dioxo-1-(3-phenylanilino)nonan-2-yl]thiophene-3-carboxamide.
| Compound Name | N-[(2S)-1,8-dioxo-1-(3-phenylanilino)nonan-2-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 69318429 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[(2S)-1,8-dioxo-1-(3-phenylanilino)nonan-2-yl]thiophene-3-carboxamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)c1ccsc1)C(=O)Nc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H28N2O3S/c1-19(29)9-4-2-7-14-24(28-25(30)22-15-16-32-18-22)26(31)27-23-13-8-12-21(17-23)20-10-5-3-6-11-20/h3,5-6,8,10-13,15-18,24H,2,4,7,9,14H2,1H3,(H,27,31)(H,28,30)/t24-/m0/s1 |
| InChIKey | RGOAVVLFWHLQMO-DEOSSOPVSA-N |
| XLogP | 5.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|