C22H33ClN4O3 — CID 69319568
(2S)-N-(3-chlorophenyl)-2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]-8-oxononanamide (PubChem CID 69319568) has the molecular formula C22H33ClN4O3 and a molecular weight of 436.98 g/mol. Its IUPAC name is (2S)-N-(3-chlorophenyl)-2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]-8-oxononanamide.
| Compound Name | (2S)-N-(3-chlorophenyl)-2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]-8-oxononanamide |
|---|---|
| PubChem CID | 69319568 |
| Molecular Formula | C22H33ClN4O3 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (2S)-N-(3-chlorophenyl)-2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]-8-oxononanamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)CN1CCN(C)CC1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H33ClN4O3/c1-17(28)7-4-3-5-10-20(22(30)24-19-9-6-8-18(23)15-19)25-21(29)16-27-13-11-26(2)12-14-27/h6,8-9,15,20H,3-5,7,10-14,16H2,1-2H3,(H,24,30)(H,25,29)/t20-/m0/s1 |
| InChIKey | MUSMSKPMUUJYCB-FQEVSTJZSA-N |
| XLogP | 2.55 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|