C22H24ClN3O4S — CID 69320843
(2S)-N-(3-chlorophenyl)-2-[(4-cyanophenyl)sulfonylamino]-8-oxononanamide (PubChem CID 69320843) has the molecular formula C22H24ClN3O4S and a molecular weight of 461.97 g/mol. Its IUPAC name is (2S)-N-(3-chlorophenyl)-2-[(4-cyanophenyl)sulfonylamino]-8-oxononanamide.
| Compound Name | (2S)-N-(3-chlorophenyl)-2-[(4-cyanophenyl)sulfonylamino]-8-oxononanamide |
|---|---|
| PubChem CID | 69320843 |
| Molecular Formula | C22H24ClN3O4S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | (2S)-N-(3-chlorophenyl)-2-[(4-cyanophenyl)sulfonylamino]-8-oxononanamide |
| SMILES | CC(=O)CCCCC[C@H](NS(=O)(=O)c1ccc(C#N)cc1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H24ClN3O4S/c1-16(27)6-3-2-4-9-21(22(28)25-19-8-5-7-18(23)14-19)26-31(29,30)20-12-10-17(15-24)11-13-20/h5,7-8,10-14,21,26H,2-4,6,9H2,1H3,(H,25,28)/t21-/m0/s1 |
| InChIKey | VPEQHYWYIXRIGJ-NRFANRHFSA-N |
| XLogP | 4.04 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|