C19H19N3O5S — CID 7679441
[(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] 2-[(4-cyanophenyl)sulfonylamino]acetate (PubChem CID 7679441) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] 2-[(4-cyanophenyl)sulfonylamino]acetate.
| Compound Name | [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] 2-[(4-cyanophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7679441 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] 2-[(4-cyanophenyl)sulfonylamino]acetate |
| SMILES | Cc1cccc(NC(=O)[C@H](C)OC(=O)CNS(=O)(=O)c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C19H19N3O5S/c1-13-4-3-5-16(10-13)22-19(24)14(2)27-18(23)12-21-28(25,26)17-8-6-15(11-20)7-9-17/h3-10,14,21H,12H2,1-2H3,(H,22,24)/t14-/m0/s1 |
| InChIKey | QGJBNUNWJJNFCX-AWEZNQCLSA-N |
| XLogP | 1.72 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |