C19H22N4O7S — CID 42977156
[1-(3-methylanilino)-1-oxopropan-2-yl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate (PubChem CID 42977156) has the molecular formula C19H22N4O7S and a molecular weight of 450.47 g/mol. Its IUPAC name is [1-(3-methylanilino)-1-oxopropan-2-yl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate.
| Compound Name | [1-(3-methylanilino)-1-oxopropan-2-yl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 42977156 |
| Molecular Formula | C19H22N4O7S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [1-(3-methylanilino)-1-oxopropan-2-yl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate |
| SMILES | CNc1ccc(S(=O)(=O)NCC(=O)OC(C)C(=O)Nc2cccc(C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H22N4O7S/c1-12-5-4-6-14(9-12)22-19(25)13(2)30-18(24)11-21-31(28,29)15-7-8-16(20-3)17(10-15)23(26)27/h4-10,13,20-21H,11H2,1-3H3,(H,22,25) |
| InChIKey | XCYIZUHXEJFASR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|