C15H22N4O8S — CID 55309127
[2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate (PubChem CID 55309127) has the molecular formula C15H22N4O8S and a molecular weight of 418.43 g/mol. Its IUPAC name is [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate.
| Compound Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 55309127 |
| Molecular Formula | C15H22N4O8S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate |
| SMILES | CNc1ccc(S(=O)(=O)NCC(=O)OCC(=O)NC(C)COC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H22N4O8S/c1-10(8-26-3)18-14(20)9-27-15(21)7-17-28(24,25)11-4-5-12(16-2)13(6-11)19(22)23/h4-6,10,16-17H,7-9H2,1-3H3,(H,18,20) |
| InChIKey | BXUYZHQZCXBCCS-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 165.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|