C13H15F3N4O7S — CID 4847619
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate (PubChem CID 4847619) has the molecular formula C13H15F3N4O7S and a molecular weight of 428.35 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 4847619 |
| Molecular Formula | C13H15F3N4O7S |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate |
| SMILES | CNc1ccc(S(=O)(=O)NCC(=O)OCC(=O)NCC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15F3N4O7S/c1-17-9-3-2-8(4-10(9)20(23)24)28(25,26)19-5-12(22)27-6-11(21)18-7-13(14,15)16/h2-4,17,19H,5-7H2,1H3,(H,18,21) |
| InChIKey | MPCLJGVIFZECEN-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|