C19H21ClN4O7S — CID 55309148
[2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate (PubChem CID 55309148) has the molecular formula C19H21ClN4O7S and a molecular weight of 484.92 g/mol. Its IUPAC name is [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate.
| Compound Name | [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 55309148 |
| Molecular Formula | C19H21ClN4O7S |
| Molecular Weight | 484.92 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate |
| SMILES | CNc1ccc(S(=O)(=O)NCC(=O)OCC(=O)NC(C)c2ccc(Cl)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21ClN4O7S/c1-12(13-3-5-14(20)6-4-13)23-18(25)11-31-19(26)10-22-32(29,30)15-7-8-16(21-2)17(9-15)24(27)28/h3-9,12,21-22H,10-11H2,1-2H3,(H,23,25) |
| InChIKey | OPTQRDKWWSFKBX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.92 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|