C17H21N5O7S2 — CID 55309101
[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate (PubChem CID 55309101) has the molecular formula C17H21N5O7S2 and a molecular weight of 471.52 g/mol. Its IUPAC name is [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate.
| Compound Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 55309101 |
| Molecular Formula | C17H21N5O7S2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetate |
| SMILES | CCN(C(C)=O)c1nc(COC(=O)CNS(=O)(=O)c2ccc(NC)c([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C17H21N5O7S2/c1-4-21(11(2)23)17-20-12(10-30-17)9-29-16(24)8-19-31(27,28)13-5-6-14(18-3)15(7-13)22(25)26/h5-7,10,18-19H,4,8-9H2,1-3H3 |
| InChIKey | OYOKMMQTTLTJSP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 160.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|