C18H19N3O5S2 — CID 55491387
[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 4-(prop-2-ynylsulfamoyl)benzoate (PubChem CID 55491387) has the molecular formula C18H19N3O5S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 4-(prop-2-ynylsulfamoyl)benzoate.
| Compound Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 4-(prop-2-ynylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55491387 |
| Molecular Formula | C18H19N3O5S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 4-(prop-2-ynylsulfamoyl)benzoate |
| SMILES | C#CCNS(=O)(=O)c1ccc(C(=O)OCc2csc(N(CC)C(C)=O)n2)cc1 |
| InChI | InChI=1S/C18H19N3O5S2/c1-4-10-19-28(24,25)16-8-6-14(7-9-16)17(23)26-11-15-12-27-18(20-15)21(5-2)13(3)22/h1,6-9,12,19H,5,10-11H2,2-3H3 |
| InChIKey | UOAPWDIMGFDTTB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|