C18H18ClN3O7S2 — CID 41153193
[(2S)-1-(3-chloroanilino)-1-oxopropan-2-yl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate (PubChem CID 41153193) has the molecular formula C18H18ClN3O7S2 and a molecular weight of 487.94 g/mol. Its IUPAC name is [(2S)-1-(3-chloroanilino)-1-oxopropan-2-yl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate.
| Compound Name | [(2S)-1-(3-chloroanilino)-1-oxopropan-2-yl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 41153193 |
| Molecular Formula | C18H18ClN3O7S2 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | [(2S)-1-(3-chloroanilino)-1-oxopropan-2-yl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate |
| SMILES | CSc1ccc(S(=O)(=O)NCC(=O)O[C@@H](C)C(=O)Nc2cccc(Cl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18ClN3O7S2/c1-11(18(24)21-13-5-3-4-12(19)8-13)29-17(23)10-20-31(27,28)14-6-7-16(30-2)15(9-14)22(25)26/h3-9,11,20H,10H2,1-2H3,(H,21,24)/t11-/m0/s1 |
| InChIKey | MBECKFAJPQKBLK-NSHDSACASA-N |
| XLogP | 2.82 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|