C14H16N4O7S2 — CID 47822755
1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate (PubChem CID 47822755) has the molecular formula C14H16N4O7S2 and a molecular weight of 416.44 g/mol. Its IUPAC name is 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate.
| Compound Name | 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 47822755 |
| Molecular Formula | C14H16N4O7S2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate |
| SMILES | CSc1ccc(S(=O)(=O)NCC(=O)OC(C)c2nnc(C)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N4O7S2/c1-8(14-17-16-9(2)25-14)24-13(19)7-15-27(22,23)10-4-5-12(26-3)11(6-10)18(20)21/h4-6,8,15H,7H2,1-3H3 |
| InChIKey | MSRPIBJZNQJNOZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|