C15H18N4O8S2 — CID 41120018
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate (PubChem CID 41120018) has the molecular formula C15H18N4O8S2 and a molecular weight of 446.46 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 41120018 |
| Molecular Formula | C15H18N4O8S2 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)CNS(=O)(=O)c1ccc(SC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18N4O8S2/c1-3-6-16-15(22)18-13(20)9-27-14(21)8-17-29(25,26)10-4-5-12(28-2)11(7-10)19(23)24/h3-5,7,17H,1,6,8-9H2,2H3,(H2,16,18,20,22) |
| InChIKey | NRHFBYOGOFAROV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 173.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|