C23H35N3O4 — CID 69323522
N-[(2S)-1-(3-methoxyanilino)-1,8-dioxononan-2-yl]-1-methylpiperidine-2-carboxamide (PubChem CID 69323522) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[(2S)-1-(3-methoxyanilino)-1,8-dioxononan-2-yl]-1-methylpiperidine-2-carboxamide.
| Compound Name | N-[(2S)-1-(3-methoxyanilino)-1,8-dioxononan-2-yl]-1-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 69323522 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | N-[(2S)-1-(3-methoxyanilino)-1,8-dioxononan-2-yl]-1-methylpiperidine-2-carboxamide |
| SMILES | COc1cccc(NC(=O)[C@H](CCCCCC(C)=O)NC(=O)C2CCCCN2C)c1 |
| InChI | InChI=1S/C23H35N3O4/c1-17(27)10-5-4-6-13-20(25-23(29)21-14-7-8-15-26(21)2)22(28)24-18-11-9-12-19(16-18)30-3/h9,11-12,16,20-21H,4-8,10,13-15H2,1-3H3,(H,24,28)(H,25,29)/t20-,21?/m0/s1 |
| InChIKey | DMZYQVCUMKEVBV-BGERDNNASA-N |
| XLogP | 3.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|