C21H24N4O4 — CID 163993312
2-benzamido-N'-nitroso-N-phenyloctanediamide (PubChem CID 163993312) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-benzamido-N'-nitroso-N-phenyloctanediamide.
| Compound Name | 2-benzamido-N'-nitroso-N-phenyloctanediamide |
|---|---|
| PubChem CID | 163993312 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-benzamido-N'-nitroso-N-phenyloctanediamide |
| SMILES | O=NNC(=O)CCCCCC(NC(=O)c1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H24N4O4/c26-19(24-25-29)15-9-3-8-14-18(21(28)22-17-12-6-2-7-13-17)23-20(27)16-10-4-1-5-11-16/h1-2,4-7,10-13,18H,3,8-9,14-15H2,(H,22,28)(H,23,27)(H,24,26,29) |
| InChIKey | UCNOOCNKIYGLTK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|