C25H34N4O4 — CID 11676844
(2S)-2-[(4-tert-butylphenyl)carbamoylamino]-N'-hydroxy-N-phenyloctanediamide (PubChem CID 11676844) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is (2S)-2-[(4-tert-butylphenyl)carbamoylamino]-N'-hydroxy-N-phenyloctanediamide.
| Compound Name | (2S)-2-[(4-tert-butylphenyl)carbamoylamino]-N'-hydroxy-N-phenyloctanediamide |
|---|---|
| PubChem CID | 11676844 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | (2S)-2-[(4-tert-butylphenyl)carbamoylamino]-N'-hydroxy-N-phenyloctanediamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)N[C@@H](CCCCCC(=O)NO)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C25H34N4O4/c1-25(2,3)18-14-16-20(17-15-18)27-24(32)28-21(12-8-5-9-13-22(30)29-33)23(31)26-19-10-6-4-7-11-19/h4,6-7,10-11,14-17,21,33H,5,8-9,12-13H2,1-3H3,(H,26,31)(H,29,30)(H2,27,28,32)/t21-/m0/s1 |
| InChIKey | FVBPYAJMPPFLAG-NRFANRHFSA-N |
| XLogP | 4.57 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|