C29H30N4O3S — CID 69319752
4-methyl-N-[(2S)-1-(naphthalen-2-ylamino)-1,8-dioxo-9-phenylnonan-2-yl]thiadiazole-5-carboxamide (PubChem CID 69319752) has the molecular formula C29H30N4O3S and a molecular weight of 514.65 g/mol. Its IUPAC name is 4-methyl-N-[(2S)-1-(naphthalen-2-ylamino)-1,8-dioxo-9-phenylnonan-2-yl]thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[(2S)-1-(naphthalen-2-ylamino)-1,8-dioxo-9-phenylnonan-2-yl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 69319752 |
| Molecular Formula | C29H30N4O3S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 4-methyl-N-[(2S)-1-(naphthalen-2-ylamino)-1,8-dioxo-9-phenylnonan-2-yl]thiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)N[C@@H](CCCCCC(=O)Cc1ccccc1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H30N4O3S/c1-20-27(37-33-32-20)29(36)31-26(15-7-3-6-14-25(34)18-21-10-4-2-5-11-21)28(35)30-24-17-16-22-12-8-9-13-23(22)19-24/h2,4-5,8-13,16-17,19,26H,3,6-7,14-15,18H2,1H3,(H,30,35)(H,31,36)/t26-/m0/s1 |
| InChIKey | POIPOTVNAYMXTO-SANMLTNESA-N |
| XLogP | 5.50 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|