C22H27N3O5 — CID 67268811
[(2S)-1-[2-(naphthalene-2-carbonyl)hydrazinyl]-1,8-dioxodecan-2-yl]carbamic acid (PubChem CID 67268811) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is [(2S)-1-[2-(naphthalene-2-carbonyl)hydrazinyl]-1,8-dioxodecan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[2-(naphthalene-2-carbonyl)hydrazinyl]-1,8-dioxodecan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67268811 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [(2S)-1-[2-(naphthalene-2-carbonyl)hydrazinyl]-1,8-dioxodecan-2-yl]carbamic acid |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)O)C(=O)NNC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H27N3O5/c1-2-18(26)10-4-3-5-11-19(23-22(29)30)21(28)25-24-20(27)17-13-12-15-8-6-7-9-16(15)14-17/h6-9,12-14,19,23H,2-5,10-11H2,1H3,(H,24,27)(H,25,28)(H,29,30)/t19-/m0/s1 |
| InChIKey | ARPVQJZMJNHBCA-IBGZPJMESA-N |
| XLogP | 3.17 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|