C20H24O2 — CID 59908425
7-methyl-1-naphthalen-2-ylnonane-1,8-dione (PubChem CID 59908425) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 7-methyl-1-naphthalen-2-ylnonane-1,8-dione.
| Compound Name | 7-methyl-1-naphthalen-2-ylnonane-1,8-dione |
|---|---|
| PubChem CID | 59908425 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 7-methyl-1-naphthalen-2-ylnonane-1,8-dione |
| SMILES | CC(=O)C(C)CCCCCC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H24O2/c1-15(16(2)21)8-4-3-5-11-20(22)19-13-12-17-9-6-7-10-18(17)14-19/h6-7,9-10,12-15H,3-5,8,11H2,1-2H3 |
| InChIKey | CKTHQWWZEJZSJQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|