C18H22O2 — CID 23072385
8-hydroxy-1-naphthalen-2-yloctan-1-one (PubChem CID 23072385) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 8-hydroxy-1-naphthalen-2-yloctan-1-one.
| Compound Name | 8-hydroxy-1-naphthalen-2-yloctan-1-one |
|---|---|
| PubChem CID | 23072385 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 8-hydroxy-1-naphthalen-2-yloctan-1-one |
| SMILES | O=C(CCCCCCCO)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H22O2/c19-13-7-3-1-2-4-10-18(20)17-12-11-15-8-5-6-9-16(15)14-17/h5-6,8-9,11-12,14,19H,1-4,7,10,13H2 |
| InChIKey | WNHJDISTKQMTAU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|