C34H45N3O11 — CID 102088016
diethyl 2-[[5-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-4-(naphthalene-2-carbonylamino)-5-oxopentanoyl]amino]pentanedioate (PubChem CID 102088016) has the molecular formula C34H45N3O11 and a molecular weight of 671.74 g/mol. Its IUPAC name is diethyl 2-[[5-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-4-(naphthalene-2-carbonylamino)-5-oxopentanoyl]amino]pentanedioate.
| Compound Name | diethyl 2-[[5-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-4-(naphthalene-2-carbonylamino)-5-oxopentanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 102088016 |
| Molecular Formula | C34H45N3O11 |
| Molecular Weight | 671.74 g/mol |
| Exact Mass | 671.31 |
| IUPAC Name | diethyl 2-[[5-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-4-(naphthalene-2-carbonylamino)-5-oxopentanoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)CCC(NC(=O)c1ccc2ccccc2c1)C(=O)NC(CCC(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C34H45N3O11/c1-5-45-29(39)19-16-26(33(43)47-7-3)35-28(38)18-15-25(36-31(41)24-14-13-22-11-9-10-12-23(22)21-24)32(42)37-27(34(44)48-8-4)17-20-30(40)46-6-2/h9-14,21,25-27H,5-8,15-20H2,1-4H3,(H,35,38)(H,36,41)(H,37,42) |
| InChIKey | MGHGLUPRJYBQGR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 192.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.74 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|