C24H25FN2O3 — CID 143212215
ethyl 4-(2-fluoro-6-methylanilino)-2-(naphthalene-2-carbonylamino)butanoate (PubChem CID 143212215) has the molecular formula C24H25FN2O3 and a molecular weight of 408.47 g/mol. Its IUPAC name is ethyl 4-(2-fluoro-6-methylanilino)-2-(naphthalene-2-carbonylamino)butanoate.
| Compound Name | ethyl 4-(2-fluoro-6-methylanilino)-2-(naphthalene-2-carbonylamino)butanoate |
|---|---|
| PubChem CID | 143212215 |
| Molecular Formula | C24H25FN2O3 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | ethyl 4-(2-fluoro-6-methylanilino)-2-(naphthalene-2-carbonylamino)butanoate |
| SMILES | CCOC(=O)C(CCNc1c(C)cccc1F)NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H25FN2O3/c1-3-30-24(29)21(13-14-26-22-16(2)7-6-10-20(22)25)27-23(28)19-12-11-17-8-4-5-9-18(17)15-19/h4-12,15,21,26H,3,13-14H2,1-2H3,(H,27,28) |
| InChIKey | XWDZULFPJKCEGO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |