C28H30N6O3 — CID 69318032
N-[(2S)-1-(naphthalen-2-ylamino)-1,8-dioxodecan-2-yl]-2-(tetrazol-1-yl)benzamide (PubChem CID 69318032) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is N-[(2S)-1-(naphthalen-2-ylamino)-1,8-dioxodecan-2-yl]-2-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(2S)-1-(naphthalen-2-ylamino)-1,8-dioxodecan-2-yl]-2-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 69318032 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | N-[(2S)-1-(naphthalen-2-ylamino)-1,8-dioxodecan-2-yl]-2-(tetrazol-1-yl)benzamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)c1ccccc1-n1cnnn1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H30N6O3/c1-2-23(35)12-4-3-5-14-25(28(37)30-22-17-16-20-10-6-7-11-21(20)18-22)31-27(36)24-13-8-9-15-26(24)34-19-29-32-33-34/h6-11,13,15-19,25H,2-5,12,14H2,1H3,(H,30,37)(H,31,36)/t25-/m0/s1 |
| InChIKey | ZIBAWPUHQUETLL-VWLOTQADSA-N |
| XLogP | 4.48 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|