C15H13N5OS2 — CID 3003057
1-[(4-methylthiadiazole-5-carbonyl)amino]-3-naphthalen-2-ylthiourea (PubChem CID 3003057) has the molecular formula C15H13N5OS2 and a molecular weight of 343.44 g/mol. Its IUPAC name is 1-[(4-methylthiadiazole-5-carbonyl)amino]-3-naphthalen-2-ylthiourea.
| Compound Name | 1-[(4-methylthiadiazole-5-carbonyl)amino]-3-naphthalen-2-ylthiourea |
|---|---|
| PubChem CID | 3003057 |
| Molecular Formula | C15H13N5OS2 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 1-[(4-methylthiadiazole-5-carbonyl)amino]-3-naphthalen-2-ylthiourea |
| SMILES | Cc1nnsc1C(=O)NNC(=S)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H13N5OS2/c1-9-13(23-20-17-9)14(21)18-19-15(22)16-12-7-6-10-4-2-3-5-11(10)8-12/h2-8H,1H3,(H,18,21)(H2,16,19,22) |
| InChIKey | RPVXTYRRAGLPOA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|