C11H10ClN5OS2 — CID 9085295
1-(4-chlorophenyl)-3-[(4-methylthiadiazole-5-carbonyl)amino]thiourea (PubChem CID 9085295) has the molecular formula C11H10ClN5OS2 and a molecular weight of 327.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(4-methylthiadiazole-5-carbonyl)amino]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[(4-methylthiadiazole-5-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 9085295 |
| Molecular Formula | C11H10ClN5OS2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(4-methylthiadiazole-5-carbonyl)amino]thiourea |
| SMILES | Cc1nnsc1C(=O)NNC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H10ClN5OS2/c1-6-9(20-17-14-6)10(18)15-16-11(19)13-8-4-2-7(12)3-5-8/h2-5H,1H3,(H,15,18)(H2,13,16,19) |
| InChIKey | WBLFKLCTYDLITH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|