C15H11ClN4OS2 — CID 10451325
1-(1,2-benzothiazole-3-carbonylamino)-3-(4-chlorophenyl)thiourea (PubChem CID 10451325) has the molecular formula C15H11ClN4OS2 and a molecular weight of 362.87 g/mol. Its IUPAC name is 1-(1,2-benzothiazole-3-carbonylamino)-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-(1,2-benzothiazole-3-carbonylamino)-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 10451325 |
| Molecular Formula | C15H11ClN4OS2 |
| Molecular Weight | 362.87 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 1-(1,2-benzothiazole-3-carbonylamino)-3-(4-chlorophenyl)thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(Cl)cc1)c1nsc2ccccc12 |
| InChI | InChI=1S/C15H11ClN4OS2/c16-9-5-7-10(8-6-9)17-15(22)19-18-14(21)13-11-3-1-2-4-12(11)23-20-13/h1-8H,(H,18,21)(H2,17,19,22) |
| InChIKey | BKRHKPULMUFHPL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.87 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|