C14H9Cl2F3N4OS — CID 2745993
1-(4-chlorophenyl)-3-[[3-chloro-5-(trifluoromethyl)pyridine-2-carbonyl]amino]thiourea (PubChem CID 2745993) has the molecular formula C14H9Cl2F3N4OS and a molecular weight of 409.22 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[3-chloro-5-(trifluoromethyl)pyridine-2-carbonyl]amino]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[[3-chloro-5-(trifluoromethyl)pyridine-2-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 2745993 |
| Molecular Formula | C14H9Cl2F3N4OS |
| Molecular Weight | 409.22 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[3-chloro-5-(trifluoromethyl)pyridine-2-carbonyl]amino]thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(Cl)cc1)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H9Cl2F3N4OS/c15-8-1-3-9(4-2-8)21-13(25)23-22-12(24)11-10(16)5-7(6-20-11)14(17,18)19/h1-6H,(H,22,24)(H2,21,23,25) |
| InChIKey | SXIDHMPECHERDI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|