C22H15Cl2F3N4O2 — CID 175305750
3-chloro-N-[4-chloro-2-[[(2-methylphenyl)methylideneamino]carbamoyl]phenyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 175305750) has the molecular formula C22H15Cl2F3N4O2 and a molecular weight of 495.29 g/mol. Its IUPAC name is 3-chloro-N-[4-chloro-2-[[(2-methylphenyl)methylideneamino]carbamoyl]phenyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | 3-chloro-N-[4-chloro-2-[[(2-methylphenyl)methylideneamino]carbamoyl]phenyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175305750 |
| Molecular Formula | C22H15Cl2F3N4O2 |
| Molecular Weight | 495.29 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 3-chloro-N-[4-chloro-2-[[(2-methylphenyl)methylideneamino]carbamoyl]phenyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | Cc1ccccc1C=NNC(=O)c1cc(Cl)ccc1NC(=O)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C22H15Cl2F3N4O2/c1-12-4-2-3-5-13(12)10-29-31-20(32)16-9-15(23)6-7-18(16)30-21(33)19-17(24)8-14(11-28-19)22(25,26)27/h2-11H,1H3,(H,30,33)(H,31,32) |
| InChIKey | BNCXSFPPTSICJD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.29 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|