C23H18ClF3N4O2 — CID 165389592
3-chloro-N-[2-methyl-6-[[(E)-(2-methylphenyl)methylideneamino]carbamoyl]phenyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 165389592) has the molecular formula C23H18ClF3N4O2 and a molecular weight of 474.87 g/mol. Its IUPAC name is 3-chloro-N-[2-methyl-6-[[(E)-(2-methylphenyl)methylideneamino]carbamoyl]phenyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | 3-chloro-N-[2-methyl-6-[[(E)-(2-methylphenyl)methylideneamino]carbamoyl]phenyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 165389592 |
| Molecular Formula | C23H18ClF3N4O2 |
| Molecular Weight | 474.87 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 3-chloro-N-[2-methyl-6-[[(E)-(2-methylphenyl)methylideneamino]carbamoyl]phenyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | Cc1ccccc1/C=N/NC(=O)c1cccc(C)c1NC(=O)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C23H18ClF3N4O2/c1-13-6-3-4-8-15(13)11-29-31-21(32)17-9-5-7-14(2)19(17)30-22(33)20-18(24)10-16(12-28-20)23(25,26)27/h3-12H,1-2H3,(H,30,33)(H,31,32)/b29-11+ |
| InChIKey | YGWMUMBNOFZFKW-VPUKRXIYSA-N |
| XLogP | 5.39 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.87 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|