C20H11Cl3F3N3O2 — CID 3839688
[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-phenylmethylidene]amino] N-(2,4-dichlorophenyl)carbamate (PubChem CID 3839688) has the molecular formula C20H11Cl3F3N3O2 and a molecular weight of 488.68 g/mol. Its IUPAC name is [[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-phenylmethylidene]amino] N-(2,4-dichlorophenyl)carbamate.
| Compound Name | [[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-phenylmethylidene]amino] N-(2,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 3839688 |
| Molecular Formula | C20H11Cl3F3N3O2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | [[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-phenylmethylidene]amino] N-(2,4-dichlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)ON=C(c1ccccc1)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C20H11Cl3F3N3O2/c21-13-6-7-16(14(22)9-13)28-19(30)31-29-17(11-4-2-1-3-5-11)18-15(23)8-12(10-27-18)20(24,25)26/h1-10H,(H,28,30) |
| InChIKey | GFZXOCDXYDCBQR-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|