C16H10Cl2F4N2O2 — CID 3850728
methyl 3-(4-chloro-2-fluoroanilino)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]prop-2-enoate (PubChem CID 3850728) has the molecular formula C16H10Cl2F4N2O2 and a molecular weight of 409.17 g/mol. Its IUPAC name is methyl 3-(4-chloro-2-fluoroanilino)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]prop-2-enoate.
| Compound Name | methyl 3-(4-chloro-2-fluoroanilino)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 3850728 |
| Molecular Formula | C16H10Cl2F4N2O2 |
| Molecular Weight | 409.17 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | methyl 3-(4-chloro-2-fluoroanilino)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]prop-2-enoate |
| SMILES | COC(=O)C(=CNc1ccc(Cl)cc1F)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H10Cl2F4N2O2/c1-26-15(25)10(7-23-13-3-2-9(17)5-12(13)19)14-11(18)4-8(6-24-14)16(20,21)22/h2-7,23H,1H3 |
| InChIKey | ABGYRGUSLOBLGX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.17 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|