C16H9ClF6N2O2 — CID 3753340
methyl 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-(2,3,4-trifluoroanilino)prop-2-enoate (PubChem CID 3753340) has the molecular formula C16H9ClF6N2O2 and a molecular weight of 410.70 g/mol. Its IUPAC name is methyl 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-(2,3,4-trifluoroanilino)prop-2-enoate.
| Compound Name | methyl 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-(2,3,4-trifluoroanilino)prop-2-enoate |
|---|---|
| PubChem CID | 3753340 |
| Molecular Formula | C16H9ClF6N2O2 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | methyl 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-(2,3,4-trifluoroanilino)prop-2-enoate |
| SMILES | COC(=O)C(=CNc1ccc(F)c(F)c1F)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H9ClF6N2O2/c1-27-15(26)8(6-24-11-3-2-10(18)12(19)13(11)20)14-9(17)4-7(5-25-14)16(21,22)23/h2-6,24H,1H3 |
| InChIKey | MCWUYIFJKFBLQF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|