C8H6F4N2O3 — CID 67467045
3-fluoro-5-(trifluoromethyl)pyridine-2-carboxamide;formic acid (PubChem CID 67467045) has the molecular formula C8H6F4N2O3 and a molecular weight of 254.14 g/mol. Its IUPAC name is 3-fluoro-5-(trifluoromethyl)pyridine-2-carboxamide;formic acid.
| Compound Name | 3-fluoro-5-(trifluoromethyl)pyridine-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 67467045 |
| Molecular Formula | C8H6F4N2O3 |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 3-fluoro-5-(trifluoromethyl)pyridine-2-carboxamide;formic acid |
| SMILES | NC(=O)c1ncc(C(F)(F)F)cc1F.O=CO |
| InChI | InChI=1S/C7H4F4N2O.CH2O2/c8-4-1-3(7(9,10)11)2-13-5(4)6(12)14;2-1-3/h1-2H,(H2,12,14);1H,(H,2,3) |
| InChIKey | ZETMQJBKCUGUFB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|