C12H6F6N4O2 — CID 103596184
3-[6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 103596184) has the molecular formula C12H6F6N4O2 and a molecular weight of 352.19 g/mol. Its IUPAC name is 3-[6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | 3-[6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103596184 |
| Molecular Formula | C12H6F6N4O2 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 3-[6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1ncc(C(F)(F)F)cc1-n1cnc(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C12H6F6N4O2/c13-11(14,15)5-1-6(9(10(19)24)20-3-5)22-4-21-7(2-8(22)23)12(16,17)18/h1-4H,(H2,19,24) |
| InChIKey | AALCMWJDNXIVCG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |