C12H14F3N3O2 — CID 134461677
2-amino-1-[3-morpholin-4-yl-5-(trifluoromethyl)-2-pyridinyl]ethanone (PubChem CID 134461677) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is 2-amino-1-[3-morpholin-4-yl-5-(trifluoromethyl)-2-pyridinyl]ethanone.
| Compound Name | 2-amino-1-[3-morpholin-4-yl-5-(trifluoromethyl)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 134461677 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-amino-1-[3-morpholin-4-yl-5-(trifluoromethyl)-2-pyridinyl]ethanone |
| SMILES | NCC(=O)c1ncc(C(F)(F)F)cc1N1CCOCC1 |
| InChI | InChI=1S/C12H14F3N3O2/c13-12(14,15)8-5-9(18-1-3-20-4-2-18)11(17-7-8)10(19)6-16/h5,7H,1-4,6,16H2 |
| InChIKey | PHMYKGQRJOMIMG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |