C14H16F3NO3 — CID 126483070
ethyl 2-morpholin-4-yl-4-(trifluoromethyl)benzoate (PubChem CID 126483070) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is ethyl 2-morpholin-4-yl-4-(trifluoromethyl)benzoate.
| Compound Name | ethyl 2-morpholin-4-yl-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 126483070 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | ethyl 2-morpholin-4-yl-4-(trifluoromethyl)benzoate |
| SMILES | CCOC(=O)c1ccc(C(F)(F)F)cc1N1CCOCC1 |
| InChI | InChI=1S/C14H16F3NO3/c1-2-21-13(19)11-4-3-10(14(15,16)17)9-12(11)18-5-7-20-8-6-18/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | YFKGJZWAKVEMBC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |