C15H16F3N3O3 — CID 142736140
ethyl 2-morpholin-4-yl-5-(trifluoromethyl)indazole-3-carboxylate (PubChem CID 142736140) has the molecular formula C15H16F3N3O3 and a molecular weight of 343.31 g/mol. Its IUPAC name is ethyl 2-morpholin-4-yl-5-(trifluoromethyl)indazole-3-carboxylate.
| Compound Name | ethyl 2-morpholin-4-yl-5-(trifluoromethyl)indazole-3-carboxylate |
|---|---|
| PubChem CID | 142736140 |
| Molecular Formula | C15H16F3N3O3 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | ethyl 2-morpholin-4-yl-5-(trifluoromethyl)indazole-3-carboxylate |
| SMILES | CCOC(=O)c1c2cc(C(F)(F)F)ccc2nn1N1CCOCC1 |
| InChI | InChI=1S/C15H16F3N3O3/c1-2-24-14(22)13-11-9-10(15(16,17)18)3-4-12(11)19-21(13)20-5-7-23-8-6-20/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | FGNSACKOBBONLN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |